C27H33Cl2N3O5 — CID 4680151
[4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 4680151) has the molecular formula C27H33Cl2N3O5 and a molecular weight of 550.48 g/mol. Its IUPAC name is [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4680151 |
| Molecular Formula | C27H33Cl2N3O5 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1ccc(OC(=O)c2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C27H33Cl2N3O5/c1-3-4-5-6-7-8-9-10-25(33)30-18-26(34)32-31-17-19-11-14-23(24(15-19)36-2)37-27(35)21-13-12-20(28)16-22(21)29/h11-17H,3-10,18H2,1-2H3,(H,30,33)(H,32,34) |
| InChIKey | CGCNHCJQHDCXMJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|