C29H37N3O5 — CID 3870684
[4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-phenylprop-2-enoate (PubChem CID 3870684) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3870684 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | [4-[[[2-(decanoylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-phenylprop-2-enoate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1ccc(OC(=O)C=Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C29H37N3O5/c1-3-4-5-6-7-8-12-15-27(33)30-22-28(34)32-31-21-24-16-18-25(26(20-24)36-2)37-29(35)19-17-23-13-10-9-11-14-23/h9-11,13-14,16-21H,3-8,12,15,22H2,1-2H3,(H,30,33)(H,32,34) |
| InChIKey | ZTUQCRBVKBCCHE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|