C26H22FN3O5 — CID 6243829
[4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6243829) has the molecular formula C26H22FN3O5 and a molecular weight of 475.48 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6243829 |
| Molecular Formula | C26H22FN3O5 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(/C=N\NC(=O)CNC(=O)c2ccc(F)cc2)ccc1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H22FN3O5/c1-34-23-15-19(7-13-22(23)35-25(32)14-8-18-5-3-2-4-6-18)16-29-30-24(31)17-28-26(33)20-9-11-21(27)12-10-20/h2-16H,17H2,1H3,(H,28,33)(H,30,31)/b14-8+,29-16- |
| InChIKey | JHSRPAROTDADLN-MPVQTZTJSA-N |
| XLogP | 3.33 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|