C25H22ClN3O5 — CID 3710426
[2-methoxy-4-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 3710426) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-methoxy-4-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3710426 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [2-methoxy-4-[[[2-[(4-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)CNC(=O)c2ccc(C)cc2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H22ClN3O5/c1-16-7-10-18(11-8-16)24(31)27-15-23(30)29-28-14-17-9-12-21(22(13-17)33-2)34-25(32)19-5-3-4-6-20(19)26/h3-14H,15H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | BZJDBQQMRHEXGZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|