C24H18Cl2FN3O5 — CID 6249023
[4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate (PubChem CID 6249023) has the molecular formula C24H18Cl2FN3O5 and a molecular weight of 518.33 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 6249023 |
| Molecular Formula | C24H18Cl2FN3O5 |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)CNC(=O)c2ccc(F)cc2)ccc1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2FN3O5/c1-34-21-10-14(2-9-20(21)35-24(33)16-5-8-18(25)19(26)11-16)12-29-30-22(31)13-28-23(32)15-3-6-17(27)7-4-15/h2-12H,13H2,1H3,(H,28,32)(H,30,31)/b29-12- |
| InChIKey | AODKUMXRPIKVBP-ULPWCQAASA-N |
| XLogP | 4.24 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|