C23H19Cl2N3O6S — CID 4226760
[4-[[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate (PubChem CID 4226760) has the molecular formula C23H19Cl2N3O6S and a molecular weight of 536.39 g/mol. Its IUPAC name is [4-[[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4226760 |
| Molecular Formula | C23H19Cl2N3O6S |
| Molecular Weight | 536.39 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | [4-[[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)CNS(=O)(=O)c2ccccc2)ccc1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl2N3O6S/c1-33-21-11-15(7-10-20(21)34-23(30)16-8-9-18(24)19(25)12-16)13-26-28-22(29)14-27-35(31,32)17-5-3-2-4-6-17/h2-13,27H,14H2,1H3,(H,28,29) |
| InChIKey | NSNQDZGXYSVRKK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|