C23H20ClN3O6S — CID 6244389
[4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 6244389) has the molecular formula C23H20ClN3O6S and a molecular weight of 501.95 g/mol. Its IUPAC name is [4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6244389 |
| Molecular Formula | C23H20ClN3O6S |
| Molecular Weight | 501.95 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | [4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)CNS(=O)(=O)c2ccccc2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O6S/c1-32-21-13-16(7-12-20(21)33-23(29)17-8-10-18(24)11-9-17)14-25-27-22(28)15-26-34(30,31)19-5-3-2-4-6-19/h2-14,26H,15H2,1H3,(H,27,28)/b25-14- |
| InChIKey | HFFXSXMZGNRVSS-QFEZKATASA-N |
| XLogP | 3.00 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.95 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|