C29H23ClN2O5 — CID 41271341
[4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 41271341) has the molecular formula C29H23ClN2O5 and a molecular weight of 514.97 g/mol. Its IUPAC name is [4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 41271341 |
| Molecular Formula | C29H23ClN2O5 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | [4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)C(O)(c2ccccc2)c2ccccc2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H23ClN2O5/c1-36-26-18-20(12-17-25(26)37-27(33)21-13-15-24(30)16-14-21)19-31-32-28(34)29(35,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-19,35H,1H3,(H,32,34)/b31-19- |
| InChIKey | DRFMKHLCZLBWIP-DXJNIWACSA-N |
| XLogP | 4.95 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|