C22H16Cl2N2O4 — CID 110341009
[4-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate (PubChem CID 110341009) has the molecular formula C22H16Cl2N2O4 and a molecular weight of 443.29 g/mol. Its IUPAC name is [4-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 110341009 |
| Molecular Formula | C22H16Cl2N2O4 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | [4-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(Cl)cc2Cl)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl2N2O4/c1-29-20-11-14(7-10-19(20)30-22(28)15-5-3-2-4-6-15)13-25-26-21(27)17-9-8-16(23)12-18(17)24/h2-13H,1H3,(H,26,27)/b25-13+ |
| InChIKey | NOSPIFIYFPYGCV-DHRITJCHSA-N |
| XLogP | 4.99 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|