C17H14Cl2N2O4 — CID 4507669
[4-[[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 4507669) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is [4-[[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 4507669 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | [4-[[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=NNC(=O)c2ccc(Cl)cc2Cl)ccc1OC(C)=O |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-10(22)25-15-6-3-11(7-16(15)24-2)9-20-21-17(23)13-5-4-12(18)8-14(13)19/h3-9H,1-2H3,(H,21,23) |
| InChIKey | WDGCZFXLHZNKKQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|