C23H18Cl2N2O5 — CID 3516860
[2-methoxy-4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3516860) has the molecular formula C23H18Cl2N2O5 and a molecular weight of 473.31 g/mol. Its IUPAC name is [2-methoxy-4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-methoxy-4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3516860 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | [2-methoxy-4-[[(3-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cccc(C(=O)NN=Cc2ccc(OC(=O)c3ccc(Cl)cc3Cl)c(OC)c2)c1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c1-30-17-5-3-4-15(11-17)22(28)27-26-13-14-6-9-20(21(10-14)31-2)32-23(29)18-8-7-16(24)12-19(18)25/h3-13H,1-2H3,(H,27,28) |
| InChIKey | NSJHBVHDGVPLDE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|