C30H23Cl2N3O5 — CID 126229300
[4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 126229300) has the molecular formula C30H23Cl2N3O5 and a molecular weight of 576.44 g/mol. Its IUPAC name is [4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126229300 |
| Molecular Formula | C30H23Cl2N3O5 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | [4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccc(Cl)cc3Cl)c2)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O5/c1-18-6-9-20(10-7-18)30(38)40-26-13-8-19(14-27(26)39-2)17-33-35-28(36)21-4-3-5-23(15-21)34-29(37)24-12-11-22(31)16-25(24)32/h3-17H,1-2H3,(H,34,37)(H,35,36) |
| InChIKey | GJZLAROMTJPYKN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|