C29H20Cl2N4O7 — CID 126233458
[4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate (PubChem CID 126233458) has the molecular formula C29H20Cl2N4O7 and a molecular weight of 607.41 g/mol. Its IUPAC name is [4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126233458 |
| Molecular Formula | C29H20Cl2N4O7 |
| Molecular Weight | 607.41 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | [4-[[[3-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccc(Cl)cc3Cl)c2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H20Cl2N4O7/c1-41-26-13-17(5-12-25(26)42-29(38)18-6-9-22(10-7-18)35(39)40)16-32-34-27(36)19-3-2-4-21(14-19)33-28(37)23-11-8-20(30)15-24(23)31/h2-16H,1H3,(H,33,37)(H,34,36) |
| InChIKey | YRZFBUXTPHCALK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.41 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|