C27H20N4O8 — CID 126231345
[4-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate (PubChem CID 126231345) has the molecular formula C27H20N4O8 and a molecular weight of 528.48 g/mol. Its IUPAC name is [4-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126231345 |
| Molecular Formula | C27H20N4O8 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | [4-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccco3)c2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H20N4O8/c1-37-24-14-17(7-12-22(24)39-27(34)18-8-10-21(11-9-18)31(35)36)16-28-30-25(32)19-4-2-5-20(15-19)29-26(33)23-6-3-13-38-23/h2-16H,1H3,(H,29,33)(H,30,32) |
| InChIKey | OYZZHUMDMRABDA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|