C27H20BrN3O6 — CID 126230370
[4-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 126230370) has the molecular formula C27H20BrN3O6 and a molecular weight of 562.38 g/mol. Its IUPAC name is [4-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126230370 |
| Molecular Formula | C27H20BrN3O6 |
| Molecular Weight | 562.38 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | [4-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccc(Br)cc3)c2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C27H20BrN3O6/c1-35-24-14-17(7-12-22(24)37-27(34)23-6-3-13-36-23)16-29-31-26(33)19-4-2-5-21(15-19)30-25(32)18-8-10-20(28)11-9-18/h2-16H,1H3,(H,30,32)(H,31,33) |
| InChIKey | JKSGMNXOPGADSA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|