C23H20BrN3O4 — CID 171135912
3-[(3-bromobenzoyl)amino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 171135912) has the molecular formula C23H20BrN3O4 and a molecular weight of 482.33 g/mol. Its IUPAC name is 3-[(3-bromobenzoyl)amino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-[(3-bromobenzoyl)amino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 171135912 |
| Molecular Formula | C23H20BrN3O4 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 3-[(3-bromobenzoyl)amino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cccc(NC(=O)c3cccc(Br)c3)c2)cc1OC |
| InChI | InChI=1S/C23H20BrN3O4/c1-30-20-10-9-15(11-21(20)31-2)14-25-27-23(29)17-6-4-8-19(13-17)26-22(28)16-5-3-7-18(24)12-16/h3-14H,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | RGGKXJZSPARECD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|