C26H25BrN2O4 — CID 51061927
[4-[(E)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate (PubChem CID 51061927) has the molecular formula C26H25BrN2O4 and a molecular weight of 509.40 g/mol. Its IUPAC name is [4-[(E)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate.
| Compound Name | [4-[(E)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 51061927 |
| Molecular Formula | C26H25BrN2O4 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [4-[(E)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(C(C)(C)C)cc2)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C26H25BrN2O4/c1-26(2,3)20-11-9-18(10-12-20)24(30)29-28-16-17-8-13-22(23(14-17)32-4)33-25(31)19-6-5-7-21(27)15-19/h5-16H,1-4H3,(H,29,30)/b28-16+ |
| InChIKey | HULWCZZRHPXVRS-LQKURTRISA-N |
| XLogP | 5.74 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|