C16H14BrN3O3S — CID 6302492
[4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 3-bromobenzoate (PubChem CID 6302492) has the molecular formula C16H14BrN3O3S and a molecular weight of 408.28 g/mol. Its IUPAC name is [4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 3-bromobenzoate.
| Compound Name | [4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 6302492 |
| Molecular Formula | C16H14BrN3O3S |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | [4-[(Z)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 3-bromobenzoate |
| SMILES | COc1cc(/C=N\NC(N)=S)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrN3O3S/c1-22-14-7-10(9-19-20-16(18)24)5-6-13(14)23-15(21)11-3-2-4-12(17)8-11/h2-9H,1H3,(H3,18,20,24)/b19-9- |
| InChIKey | VHKPTFWSQRYASL-OCKHKDLRSA-N |
| XLogP | 2.84 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|