C17H16BrN3O4S — CID 6108948
[4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 6108948) has the molecular formula C17H16BrN3O4S and a molecular weight of 438.30 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 6108948 |
| Molecular Formula | C17H16BrN3O4S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | [4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(N)=S)cc1OC |
| InChI | InChI=1S/C17H16BrN3O4S/c1-23-14-5-3-10(8-15(14)24-2)16(22)25-13-6-4-12(18)7-11(13)9-20-21-17(19)26/h3-9H,1-2H3,(H3,19,21,26)/b20-9- |
| InChIKey | SPFVGPQFCOBFEQ-UKWGHVSLSA-N |
| XLogP | 2.85 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|