C23H19BrN2O5 — CID 4598827
[4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 4598827) has the molecular formula C23H19BrN2O5 and a molecular weight of 483.32 g/mol. Its IUPAC name is [4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 4598827 |
| Molecular Formula | C23H19BrN2O5 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1ccc(C(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H19BrN2O5/c1-29-20-10-8-16(13-21(20)30-2)22(27)26-25-14-17-12-18(24)9-11-19(17)31-23(28)15-6-4-3-5-7-15/h3-14H,1-2H3,(H,26,27) |
| InChIKey | ISYJIFOPHJNVNR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|