C25H21BrN2O5 — CID 6073791
[4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6073791) has the molecular formula C25H21BrN2O5 and a molecular weight of 509.36 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6073791 |
| Molecular Formula | C25H21BrN2O5 |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | [4-bromo-2-[(Z)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(Br)ccc2OC(=O)/C=C/c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H21BrN2O5/c1-31-22-11-9-18(15-23(22)32-2)25(30)28-27-16-19-14-20(26)10-12-21(19)33-24(29)13-8-17-6-4-3-5-7-17/h3-16H,1-2H3,(H,28,30)/b13-8+,27-16- |
| InChIKey | BZMMOTAINKLBTE-NPUPLTGBSA-N |
| XLogP | 4.85 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|