C24H19BrN2O4 — CID 6074258
[4-bromo-2-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6074258) has the molecular formula C24H19BrN2O4 and a molecular weight of 479.33 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6074258 |
| Molecular Formula | C24H19BrN2O4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | [4-bromo-2-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(Br)ccc2OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19BrN2O4/c1-30-21-11-8-18(9-12-21)24(29)27-26-16-19-15-20(25)10-13-22(19)31-23(28)14-7-17-5-3-2-4-6-17/h2-16H,1H3,(H,27,29)/b14-7+,26-16- |
| InChIKey | MQLFLKUYRKAPSE-BFRREZCOSA-N |
| XLogP | 4.84 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|