C24H19BrN2O3 — CID 4251218
[4-bromo-2-[[(3-methylbenzoyl)hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4251218) has the molecular formula C24H19BrN2O3 and a molecular weight of 463.33 g/mol. Its IUPAC name is [4-bromo-2-[[(3-methylbenzoyl)hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[[(3-methylbenzoyl)hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4251218 |
| Molecular Formula | C24H19BrN2O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [4-bromo-2-[[(3-methylbenzoyl)hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | Cc1cccc(C(=O)NN=Cc2cc(Br)ccc2OC(=O)C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H19BrN2O3/c1-17-6-5-9-19(14-17)24(29)27-26-16-20-15-21(25)11-12-22(20)30-23(28)13-10-18-7-3-2-4-8-18/h2-16H,1H3,(H,27,29) |
| InChIKey | XXIPYJMRYOMKSF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|