C22H17BrN2O4 — CID 6019115
[4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 6019115) has the molecular formula C22H17BrN2O4 and a molecular weight of 453.29 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 6019115 |
| Molecular Formula | C22H17BrN2O4 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | [4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C22H17BrN2O4/c1-14-5-4-6-15(11-14)22(28)29-20-10-9-17(23)12-16(20)13-24-25-21(27)18-7-2-3-8-19(18)26/h2-13,26H,1H3,(H,25,27)/b24-13- |
| InChIKey | UGDVXCSWTRQUEX-CFRMEGHHSA-N |
| XLogP | 4.45 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|