C30H24BrN3O5 — CID 126003370
[4-bromo-2-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 126003370) has the molecular formula C30H24BrN3O5 and a molecular weight of 586.44 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126003370 |
| Molecular Formula | C30H24BrN3O5 |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)N/N=C\c2cc(Br)ccc2OC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C30H24BrN3O5/c1-19-6-5-7-21(16-19)30(37)39-27-15-12-23(31)17-22(27)18-32-34-29(36)25-8-3-4-9-26(25)33-28(35)20-10-13-24(38-2)14-11-20/h3-18H,1-2H3,(H,33,35)(H,34,36)/b32-18- |
| InChIKey | JVBIZELGGWKJCJ-CAQPMQTCSA-N |
| XLogP | 6.00 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|