C32H29N3O7 — CID 126003783
[2-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 126003783) has the molecular formula C32H29N3O7 and a molecular weight of 567.60 g/mol. Its IUPAC name is [2-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [2-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126003783 |
| Molecular Formula | C32H29N3O7 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | [2-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)N/N=C\c2ccccc2OC(=O)c2cccc(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H29N3O7/c1-20-10-9-12-21(16-20)32(38)42-26-15-8-5-11-22(26)19-33-35-31(37)24-13-6-7-14-25(24)34-30(36)23-17-27(39-2)29(41-4)28(18-23)40-3/h5-19H,1-4H3,(H,34,36)(H,35,37)/b33-19- |
| InChIKey | LKYIJWVJHDZIHZ-APTWKGOFSA-N |
| XLogP | 5.26 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|