C37H30N2O8 — CID 126020848
[2-[(E)-3-[2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126020848) has the molecular formula C37H30N2O8 and a molecular weight of 630.65 g/mol. Its IUPAC name is [2-[(E)-3-[2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(E)-3-[2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126020848 |
| Molecular Formula | C37H30N2O8 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | [2-[(E)-3-[2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2/C=C/C(=O)Oc2ccccc2/C=N/NC(=O)c2cccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C37H30N2O8/c1-43-32-21-27(22-33(44-2)35(32)45-3)37(42)47-30-17-8-5-12-25(30)19-20-34(40)46-31-18-9-6-13-26(31)23-38-39-36(41)29-16-10-14-24-11-4-7-15-28(24)29/h4-23H,1-3H3,(H,39,41)/b20-19+,38-23+ |
| InChIKey | HXWOFIOFZJGKSR-IFZOIONZSA-N |
| XLogP | 6.47 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|