C40H33N3O9 — CID 126012969
[2-[(E)-3-[2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126012969) has the molecular formula C40H33N3O9 and a molecular weight of 699.72 g/mol. Its IUPAC name is [2-[(E)-3-[2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(E)-3-[2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126012969 |
| Molecular Formula | C40H33N3O9 |
| Molecular Weight | 699.72 g/mol |
| Exact Mass | 699.22 |
| IUPAC Name | [2-[(E)-3-[2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2/C=C/C(=O)Oc2ccccc2/C=N/NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C40H33N3O9/c1-48-34-23-30(24-35(49-2)37(34)50-3)40(47)52-32-15-9-7-11-26(32)19-22-36(44)51-33-16-10-8-14-29(33)25-41-43-39(46)28-17-20-31(21-18-28)42-38(45)27-12-5-4-6-13-27/h4-25H,1-3H3,(H,42,45)(H,43,46)/b22-19+,41-25+ |
| InChIKey | NIMHMTMBKPGCCX-ZLLQOKORSA-N |
| XLogP | 6.57 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|