C29H31N3O7 — CID 3104580
[2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3104580) has the molecular formula C29H31N3O7 and a molecular weight of 533.58 g/mol. Its IUPAC name is [2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3104580 |
| Molecular Formula | C29H31N3O7 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | [2-[[[4-(2,2-dimethylpropanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2C=NNC(=O)c2ccc(NC(=O)C(C)(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N3O7/c1-29(2,3)28(35)31-21-13-11-18(12-14-21)26(33)32-30-17-19-9-7-8-10-22(19)39-27(34)20-15-23(36-4)25(38-6)24(16-20)37-5/h7-17H,1-6H3,(H,31,35)(H,32,33) |
| InChIKey | JSWSYDFEOOOWTC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|