C42H35N3O9 — CID 126027133
[2-[(E)-3-oxo-3-[2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126027133) has the molecular formula C42H35N3O9 and a molecular weight of 725.75 g/mol. Its IUPAC name is [2-[(E)-3-oxo-3-[2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(E)-3-oxo-3-[2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126027133 |
| Molecular Formula | C42H35N3O9 |
| Molecular Weight | 725.75 g/mol |
| Exact Mass | 725.24 |
| IUPAC Name | [2-[(E)-3-oxo-3-[2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)N/N=C/c3ccccc3OC(=O)/C=C/c3ccccc3OC(=O)/C=C/c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C42H35N3O9/c1-50-36-25-32(26-37(51-2)40(36)52-3)41(48)44-33-21-18-30(19-22-33)42(49)45-43-27-31-14-8-10-16-35(31)54-39(47)24-20-29-13-7-9-15-34(29)53-38(46)23-17-28-11-5-4-6-12-28/h4-27H,1-3H3,(H,44,48)(H,45,49)/b23-17+,24-20+,43-27+ |
| InChIKey | QKCVPRUEWHNYIZ-AZBGGCCFSA-N |
| XLogP | 6.97 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.75 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|