C32H23BrN2O5 — CID 126013242
[2-[(E)-3-[2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126013242) has the molecular formula C32H23BrN2O5 and a molecular weight of 595.45 g/mol. Its IUPAC name is [2-[(E)-3-[2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(E)-3-[2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126013242 |
| Molecular Formula | C32H23BrN2O5 |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | [2-[(E)-3-[2-[(E)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccccc1/C=C/C(=O)Oc1ccccc1/C=N/NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H23BrN2O5/c33-27-18-15-25(16-19-27)32(38)35-34-22-26-11-5-7-13-29(26)40-31(37)21-17-24-10-4-6-12-28(24)39-30(36)20-14-23-8-2-1-3-9-23/h1-22H,(H,35,38)/b20-14+,21-17+,34-22+ |
| InChIKey | QKNOHBNLIFETJG-VQDGDVBUSA-N |
| XLogP | 6.45 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|