C30H22BrN3O4 — CID 126004508
[2-[(Z)-[[2-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126004508) has the molecular formula C30H22BrN3O4 and a molecular weight of 568.43 g/mol. Its IUPAC name is [2-[(Z)-[[2-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(Z)-[[2-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126004508 |
| Molecular Formula | C30H22BrN3O4 |
| Molecular Weight | 568.43 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | [2-[(Z)-[[2-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccccc1/C=N\NC(=O)c1ccccc1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H22BrN3O4/c31-24-17-15-22(16-18-24)29(36)33-26-12-6-5-11-25(26)30(37)34-32-20-23-10-4-7-13-27(23)38-28(35)19-14-21-8-2-1-3-9-21/h1-20H,(H,33,36)(H,34,37)/b19-14+,32-20- |
| InChIKey | OZZAUNVOFBBSHJ-QQMURXAZSA-N |
| XLogP | 6.08 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|