C30H20BrCl2N3O4 — CID 126003608
[4-bromo-2-[(Z)-[[2-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126003608) has the molecular formula C30H20BrCl2N3O4 and a molecular weight of 637.32 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126003608 |
| Molecular Formula | C30H20BrCl2N3O4 |
| Molecular Weight | 637.32 g/mol |
| Exact Mass | 635.00 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-[(2,4-dichlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccc(Br)cc1/C=N\NC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H20BrCl2N3O4/c31-21-11-14-27(40-28(37)15-10-19-6-2-1-3-7-19)20(16-21)18-34-36-30(39)24-8-4-5-9-26(24)35-29(38)23-13-12-22(32)17-25(23)33/h1-18H,(H,35,38)(H,36,39)/b15-10+,34-18- |
| InChIKey | KXDQAHQYJRCMJB-PTWZITAHSA-N |
| XLogP | 7.39 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.32 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|