C24H18BrClN2O4 — CID 5103095
[4-bromo-2-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 5103095) has the molecular formula C24H18BrClN2O4 and a molecular weight of 513.78 g/mol. Its IUPAC name is [4-bromo-2-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 5103095 |
| Molecular Formula | C24H18BrClN2O4 |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | [4-bromo-2-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | O=C(COc1cccc(Cl)c1)NN=Cc1cc(Br)ccc1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H18BrClN2O4/c25-19-10-11-22(32-24(30)12-9-17-5-2-1-3-6-17)18(13-19)15-27-28-23(29)16-31-21-8-4-7-20(26)14-21/h1-15H,16H2,(H,28,29) |
| InChIKey | FWNBUKRFRPZUSJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|