C26H18BrClN2O4 — CID 5011763
[4-bromo-2-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 5011763) has the molecular formula C26H18BrClN2O4 and a molecular weight of 537.80 g/mol. Its IUPAC name is [4-bromo-2-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-bromo-2-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 5011763 |
| Molecular Formula | C26H18BrClN2O4 |
| Molecular Weight | 537.80 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | [4-bromo-2-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(COc1ccc2ccccc2c1)NN=Cc1cc(Br)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H18BrClN2O4/c27-20-10-12-24(34-26(32)22-7-3-4-8-23(22)28)19(13-20)15-29-30-25(31)16-33-21-11-9-17-5-1-2-6-18(17)14-21/h1-15H,16H2,(H,30,31) |
| InChIKey | CSTRCZANSIKMSM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|