C23H18BrClN2O5 — CID 5112810
[4-bromo-2-[[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 5112810) has the molecular formula C23H18BrClN2O5 and a molecular weight of 517.76 g/mol. Its IUPAC name is [4-bromo-2-[[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 5112810 |
| Molecular Formula | C23H18BrClN2O5 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | [4-bromo-2-[[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1ccc(OCC(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H18BrClN2O5/c1-30-19-7-9-20(10-8-19)31-14-22(28)27-26-13-16-12-17(24)4-11-21(16)32-23(29)15-2-5-18(25)6-3-15/h2-13H,14H2,1H3,(H,27,28) |
| InChIKey | MWQVNLLBUJDAEX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|