C24H20BrClN2O4 — CID 6075626
[4-bromo-2-[(Z)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6075626) has the molecular formula C24H20BrClN2O4 and a molecular weight of 515.79 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6075626 |
| Molecular Formula | C24H20BrClN2O4 |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | Cc1ccc(C)c(OCC(=O)N/N=C\c2cc(Br)ccc2OC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H20BrClN2O4/c1-15-3-4-16(2)22(11-15)31-14-23(29)28-27-13-18-12-19(25)7-10-21(18)32-24(30)17-5-8-20(26)9-6-17/h3-13H,14H2,1-2H3,(H,28,29)/b27-13- |
| InChIKey | SJJHTRBWVYQKAK-WKIKZPBSSA-N |
| XLogP | 5.47 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|