C26H25BrN2O5 — CID 6147330
[4-bromo-2-[(Z)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate (PubChem CID 6147330) has the molecular formula C26H25BrN2O5 and a molecular weight of 525.40 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 6147330 |
| Molecular Formula | C26H25BrN2O5 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-(3,4-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(=O)COc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H25BrN2O5/c1-4-32-22-10-6-19(7-11-22)26(31)34-24-12-8-21(27)14-20(24)15-28-29-25(30)16-33-23-9-5-17(2)18(3)13-23/h5-15H,4,16H2,1-3H3,(H,29,30)/b28-15- |
| InChIKey | RAYNPRYISGNDMU-MBTHVWNTSA-N |
| XLogP | 5.21 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|