C24H21BrN2O4 — CID 4619201
[4-bromo-2-[[[2-(4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 4619201) has the molecular formula C24H21BrN2O4 and a molecular weight of 481.35 g/mol. Its IUPAC name is [4-bromo-2-[[[2-(4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-bromo-2-[[[2-(4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4619201 |
| Molecular Formula | C24H21BrN2O4 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [4-bromo-2-[[[2-(4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(OCC(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H21BrN2O4/c1-16-3-7-18(8-4-16)24(29)31-22-12-9-20(25)13-19(22)14-26-27-23(28)15-30-21-10-5-17(2)6-11-21/h3-14H,15H2,1-2H3,(H,27,28) |
| InChIKey | COVYLSQTPJKMIP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|