C27H27BrN2O5 — CID 6033006
[4-bromo-2-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 6033006) has the molecular formula C27H27BrN2O5 and a molecular weight of 539.43 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 6033006 |
| Molecular Formula | C27H27BrN2O5 |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | CCCCOc1ccc(OCC(=O)N/N=C\c2cc(Br)ccc2OC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H27BrN2O5/c1-3-4-14-33-23-9-11-24(12-10-23)34-18-26(31)30-29-17-21-16-22(28)8-13-25(21)35-27(32)20-7-5-6-19(2)15-20/h5-13,15-17H,3-4,14,18H2,1-2H3,(H,30,31)/b29-17- |
| InChIKey | SGLRQIPNWMEMKR-RHANQZHGSA-N |
| XLogP | 5.68 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|