C23H18BrFN2O4 — CID 6285370
[4-bromo-2-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 6285370) has the molecular formula C23H18BrFN2O4 and a molecular weight of 485.31 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 6285370 |
| Molecular Formula | C23H18BrFN2O4 |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(=O)COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H18BrFN2O4/c1-15-3-2-4-16(11-15)23(29)31-21-10-5-18(24)12-17(21)13-26-27-22(28)14-30-20-8-6-19(25)7-9-20/h2-13H,14H2,1H3,(H,27,28)/b26-13- |
| InChIKey | SEQFLVVPCWOCCC-ZMFRSBBQSA-N |
| XLogP | 4.64 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|