C24H18BrFN2O4 — CID 4655202
[4-bromo-2-[[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4655202) has the molecular formula C24H18BrFN2O4 and a molecular weight of 497.32 g/mol. Its IUPAC name is [4-bromo-2-[[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4655202 |
| Molecular Formula | C24H18BrFN2O4 |
| Molecular Weight | 497.32 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | [4-bromo-2-[[[2-(4-fluorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | O=C(COc1ccc(F)cc1)NN=Cc1cc(Br)ccc1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H18BrFN2O4/c25-19-7-12-22(32-24(30)13-6-17-4-2-1-3-5-17)18(14-19)15-27-28-23(29)16-31-21-10-8-20(26)9-11-21/h1-15H,16H2,(H,28,29) |
| InChIKey | SJVMRTNANGYYRF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|