C32H27BrN2O5 — CID 4069532
[4-bromo-2-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4069532) has the molecular formula C32H27BrN2O5 and a molecular weight of 599.48 g/mol. Its IUPAC name is [4-bromo-2-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4069532 |
| Molecular Formula | C32H27BrN2O5 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | [4-bromo-2-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | CC(Oc1ccc(OCc2ccccc2)cc1)C(=O)NN=Cc1cc(Br)ccc1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C32H27BrN2O5/c1-23(39-29-16-14-28(15-17-29)38-22-25-10-6-3-7-11-25)32(37)35-34-21-26-20-27(33)13-18-30(26)40-31(36)19-12-24-8-4-2-5-9-24/h2-21,23H,22H2,1H3,(H,35,37) |
| InChIKey | XCOJHWWUBLFMBO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|