C32H28N2O5 — CID 4193307
[4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4193307) has the molecular formula C32H28N2O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is [4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4193307 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | CC(Oc1ccc(OCc2ccccc2)cc1)C(=O)NN=Cc1ccc(OC(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N2O5/c1-24(38-29-19-17-28(18-20-29)37-23-27-10-6-3-7-11-27)32(36)34-33-22-26-12-15-30(16-13-26)39-31(35)21-14-25-8-4-2-5-9-25/h2-22,24H,23H2,1H3,(H,34,36) |
| InChIKey | LAJAOOCUAYRGDC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|