C30H25BrN2O5 — CID 3415013
[4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 2-bromobenzoate (PubChem CID 3415013) has the molecular formula C30H25BrN2O5 and a molecular weight of 573.44 g/mol. Its IUPAC name is [4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 2-bromobenzoate.
| Compound Name | [4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 3415013 |
| Molecular Formula | C30H25BrN2O5 |
| Molecular Weight | 573.44 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | [4-[[2-(4-phenylmethoxyphenoxy)propanoylhydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| SMILES | CC(Oc1ccc(OCc2ccccc2)cc1)C(=O)NN=Cc1ccc(OC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C30H25BrN2O5/c1-21(37-25-17-15-24(16-18-25)36-20-23-7-3-2-4-8-23)29(34)33-32-19-22-11-13-26(14-12-22)38-30(35)27-9-5-6-10-28(27)31/h2-19,21H,20H2,1H3,(H,33,34) |
| InChIKey | CSNICQCAUWFWJC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|