C30H22Cl2N2O7 — CID 6027022
[3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6027022) has the molecular formula C30H22Cl2N2O7 and a molecular weight of 593.42 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6027022 |
| Molecular Formula | C30H22Cl2N2O7 |
| Molecular Weight | 593.42 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1ccc(OCC(=O)N/N=C\c2ccc(OC(=O)c3ccc(Cl)cc3)cc2OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H22Cl2N2O7/c1-38-24-12-14-25(15-13-24)39-18-28(35)34-33-17-21-6-11-26(40-29(36)19-2-7-22(31)8-3-19)16-27(21)41-30(37)20-4-9-23(32)10-5-20/h2-17H,18H2,1H3,(H,34,35)/b33-17- |
| InChIKey | GQNOPNDAGSYUSK-FZPRHHONSA-N |
| XLogP | 5.97 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|