C29H20Cl2N2O6 — CID 6265022
[3-benzoyloxy-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 6265022) has the molecular formula C29H20Cl2N2O6 and a molecular weight of 563.39 g/mol. Its IUPAC name is [3-benzoyloxy-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6265022 |
| Molecular Formula | C29H20Cl2N2O6 |
| Molecular Weight | 563.39 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | [3-benzoyloxy-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H20Cl2N2O6/c30-22-12-14-25(24(31)15-22)37-18-27(34)33-32-17-21-11-13-23(38-28(35)19-7-3-1-4-8-19)16-26(21)39-29(36)20-9-5-2-6-10-20/h1-17H,18H2,(H,33,34)/b32-17- |
| InChIKey | YQYHXKFWJRQGJU-KYHGBAKBSA-N |
| XLogP | 5.96 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|