C33H28Cl2N2O7 — CID 6058007
[4-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]-3-(4-chlorobenzoyl)oxyphenyl] 4-chlorobenzoate (PubChem CID 6058007) has the molecular formula C33H28Cl2N2O7 and a molecular weight of 635.50 g/mol. Its IUPAC name is [4-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]-3-(4-chlorobenzoyl)oxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]-3-(4-chlorobenzoyl)oxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6058007 |
| Molecular Formula | C33H28Cl2N2O7 |
| Molecular Weight | 635.50 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | [4-[(Z)-[[2-(4-butoxyphenoxy)acetyl]hydrazinylidene]methyl]-3-(4-chlorobenzoyl)oxyphenyl] 4-chlorobenzoate |
| SMILES | CCCCOc1ccc(OCC(=O)N/N=C\c2ccc(OC(=O)c3ccc(Cl)cc3)cc2OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H28Cl2N2O7/c1-2-3-18-41-27-14-16-28(17-15-27)42-21-31(38)37-36-20-24-8-13-29(43-32(39)22-4-9-25(34)10-5-22)19-30(24)44-33(40)23-6-11-26(35)12-7-23/h4-17,19-20H,2-3,18,21H2,1H3,(H,37,38)/b36-20- |
| InChIKey | XGVUPKZOWBETNG-QJOVZPHJSA-N |
| XLogP | 7.14 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.50 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|