C31H34N2O5 — CID 6115923
[3-benzoyloxy-4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] benzoate (PubChem CID 6115923) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is [3-benzoyloxy-4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6115923 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [3-benzoyloxy-4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] benzoate |
| SMILES | CCCCCCCCCC(=O)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H34N2O5/c1-2-3-4-5-6-7-14-19-29(34)33-32-23-26-20-21-27(37-30(35)24-15-10-8-11-16-24)22-28(26)38-31(36)25-17-12-9-13-18-25/h8-13,15-18,20-23H,2-7,14,19H2,1H3,(H,33,34)/b32-23- |
| InChIKey | HZZWOEXVIBMPGR-SJIPCVTESA-N |
| XLogP | 6.72 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|