C39H40N4O8 — CID 6019219
[2-[(Z)-[[9-[(2Z)-2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-9-oxononanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 6019219) has the molecular formula C39H40N4O8 and a molecular weight of 692.77 g/mol. Its IUPAC name is [2-[(Z)-[[9-[(2Z)-2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-9-oxononanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-[(Z)-[[9-[(2Z)-2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-9-oxononanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6019219 |
| Molecular Formula | C39H40N4O8 |
| Molecular Weight | 692.77 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | [2-[(Z)-[[9-[(2Z)-2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-9-oxononanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2/C=N\NC(=O)CCCCCCCC(=O)N/N=C\c2ccccc2OC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H40N4O8/c1-48-32-22-18-28(19-23-32)38(46)50-34-14-10-8-12-30(34)26-40-42-36(44)16-6-4-3-5-7-17-37(45)43-41-27-31-13-9-11-15-35(31)51-39(47)29-20-24-33(49-2)25-21-29/h8-15,18-27H,3-7,16-17H2,1-2H3,(H,42,44)(H,43,45)/b40-26-,41-27- |
| InChIKey | JHZLWJWUMACKDP-HOKVGLHCSA-N |
| XLogP | 6.47 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.77 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|